BDBM50664868 CHEMBL6169181::US20260078122, Example 3
SMILES Cc1cc2[nH]c(=O)c(N)c(-c3ccc(F)c4[nH]ncc34)c2nc1Cl
InChI Key InChIKey=SPOLXGJDJICNND-UHFFFAOYSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 50664868
TargetMembrane-associated tyrosine- and threonine-specific cdc2-inhibitory kinase(Human)
Hoffmann-La Roche
US Patent
Hoffmann-La Roche
US Patent
Affinity DataIC50: 10nMAssay Description:CHO-K1 cells expressing Ga16 and hGPR120 were dispensed into each well of a 96-well plate (3×104 cells/100 μl/well) and then incubated in 5% CO2...More data for this Ligand-Target Pair
TargetMembrane-associated tyrosine- and threonine-specific cdc2-inhibitory kinase(Human)
Hoffmann-La Roche
US Patent
Hoffmann-La Roche
US Patent
